C15H18F3NO3 — CID 166263852
2-(oxan-4-yl)-3-[(2,3,5-trifluorophenyl)methylamino]propanoic acid (PubChem CID 166263852) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 2-(oxan-4-yl)-3-[(2,3,5-trifluorophenyl)methylamino]propanoic acid.
| Compound Name | 2-(oxan-4-yl)-3-[(2,3,5-trifluorophenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 166263852 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-(oxan-4-yl)-3-[(2,3,5-trifluorophenyl)methylamino]propanoic acid |
| SMILES | O=C(O)C(CNCc1cc(F)cc(F)c1F)C1CCOCC1 |
| InChI | InChI=1S/C15H18F3NO3/c16-11-5-10(14(18)13(17)6-11)7-19-8-12(15(20)21)9-1-3-22-4-2-9/h5-6,9,12,19H,1-4,7-8H2,(H,20,21) |
| InChIKey | QANJINSYAXGLMC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|