About 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid
5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid (PubChem CID 166264354) has the molecular formula C15H19NO6S
and a molecular weight of 341.39 g/mol. Its IUPAC name is 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid.
Molecular Properties
| Compound Name | 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid |
| PubChem CID | 166264354 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1cc(S(=O)(=O)N2CC=CC2(C)C)cc(C(=O)O)c1OC |
| InChI | InChI=1S/C15H19NO6S/c1-15(2)6-5-7-16(15)23(19,20)10-8-11(14(17)18)13(22-4)12(9-10)21-3/h5-6,8-9H,7H2,1-4H3,(H,17,18) |
| InChIKey | MEVGYEOSPOQYAF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid?
The IUPAC name of 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid (CID 166264354) is 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid.
What is the SMILES notation for 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid?
The canonical SMILES for 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid is COc1cc(S(=O)(=O)N2CC=CC2(C)C)cc(C(=O)O)c1OC.
What is the InChIKey of 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid?
The InChIKey is MEVGYEOSPOQYAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO6S/c1-15(2)6-5-7-16(15)23(19,20)10-8-11(14(17)18)13(22-4)12(9-10)21-3/h5-6,8-9H,7H2,1-4H3,(H,17,18).
What are the key properties of 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid?
5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid has a molecular weight of 341.39 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5,5-dimethyl-2H-pyrrol-1-yl)sulfonyl]-2,3-dimethoxybenzoic acid is sourced from PubChem (CID 166264354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).