About sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate
sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate (PubChem CID 166264480) has the molecular formula C15H15BrNNaO3
and a molecular weight of 360.18 g/mol. Its IUPAC name is sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate |
| PubChem CID | 166264480 |
| Molecular Formula | C15H15BrNNaO3 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate |
| SMILES | O=C(CC1(C(=O)[O-])CC1)N[C@@H]1C[C@H]1c1ccccc1Br.[Na+] |
| InChI | InChI=1S/C15H16BrNO3.Na/c16-11-4-2-1-3-9(11)10-7-12(10)17-13(18)8-15(5-6-15)14(19)20;/h1-4,10,12H,5-8H2,(H,17,18)(H,19,20);/q;+1/p-1/t10-,12+;/m0./s1 |
| InChIKey | IRHXVSFLTZHZMW-XOZOLZJESA-M |
| XLogP | -1.65 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate?
The IUPAC name of sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate (CID 166264480) is sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate.
What is the SMILES notation for sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate?
The canonical SMILES for sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate is O=C(CC1(C(=O)[O-])CC1)N[C@@H]1C[C@H]1c1ccccc1Br.[Na+].
What is the InChIKey of sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate?
The InChIKey is IRHXVSFLTZHZMW-XOZOLZJESA-M. The full InChI is InChI=1S/C15H16BrNO3.Na/c16-11-4-2-1-3-9(11)10-7-12(10)17-13(18)8-15(5-6-15)14(19)20;/h1-4,10,12H,5-8H2,(H,17,18)(H,19,20);/q;+1/p-1/t10-,12+;/m0./s1.
What are the key properties of sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate?
sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate has a molecular weight of 360.18 g/mol, XLogP of -1.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-[2-[[(1R,2S)-2-(2-bromophenyl)cyclopropyl]amino]-2-oxoethyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 166264480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).