About 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide
3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide (PubChem CID 166264766) has the molecular formula C17H18FN5O2
and a molecular weight of 343.36 g/mol. Its IUPAC name is 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide.
Molecular Properties
| Compound Name | 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide |
| PubChem CID | 166264766 |
| Molecular Formula | C17H18FN5O2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2cn3ccccc3n2)n1)C1(F)CCCOC1 |
| InChI | InChI=1S/C17H18FN5O2/c18-17(6-3-9-25-12-17)16(24)20-14-5-8-23(21-14)11-13-10-22-7-2-1-4-15(22)19-13/h1-2,4-5,7-8,10H,3,6,9,11-12H2,(H,20,21,24) |
| InChIKey | DXFBTXVDAZRKLU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide?
The IUPAC name of 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide (CID 166264766) is 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide.
What is the SMILES notation for 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide?
The canonical SMILES for 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide is O=C(Nc1ccn(Cc2cn3ccccc3n2)n1)C1(F)CCCOC1.
What is the InChIKey of 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide?
The InChIKey is DXFBTXVDAZRKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN5O2/c18-17(6-3-9-25-12-17)16(24)20-14-5-8-23(21-14)11-13-10-22-7-2-1-4-15(22)19-13/h1-2,4-5,7-8,10H,3,6,9,11-12H2,(H,20,21,24).
What are the key properties of 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide?
3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide has a molecular weight of 343.36 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-3-yl]oxane-3-carboxamide is sourced from PubChem (CID 166264766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).