About N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide
N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide (PubChem CID 166264996) has the molecular formula C14H22IN3
and a molecular weight of 359.26 g/mol. Its IUPAC name is N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide.
Molecular Properties
| Compound Name | N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
| PubChem CID | 166264996 |
| Molecular Formula | C14H22IN3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
| SMILES | CCC(CC)NC1=NCC(c2ccccc2)N1.I |
| InChI | InChI=1S/C14H21N3.HI/c1-3-12(4-2)16-14-15-10-13(17-14)11-8-6-5-7-9-11;/h5-9,12-13H,3-4,10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | XZQVRQCFRSEVSG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide?
The IUPAC name of N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide (CID 166264996) is N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide.
What is the SMILES notation for N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide?
The canonical SMILES for N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide is CCC(CC)NC1=NCC(c2ccccc2)N1.I.
What is the InChIKey of N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide?
The InChIKey is XZQVRQCFRSEVSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3.HI/c1-3-12(4-2)16-14-15-10-13(17-14)11-8-6-5-7-9-11;/h5-9,12-13H,3-4,10H2,1-2H3,(H2,15,16,17);1H.
What are the key properties of N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide?
N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide has a molecular weight of 359.26 g/mol, XLogP of 3.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentan-3-yl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide is sourced from PubChem (CID 166264996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).