C12H18N4S — CID 166265063
(8aR)-N-[1-(1,2-thiazol-5-yl)ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 166265063) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is (8aR)-N-[1-(1,2-thiazol-5-yl)ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | (8aR)-N-[1-(1,2-thiazol-5-yl)ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 166265063 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (8aR)-N-[1-(1,2-thiazol-5-yl)ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | CC(NC1=NC[C@H]2CCCCN12)c1ccns1 |
| InChI | InChI=1S/C12H18N4S/c1-9(11-5-6-14-17-11)15-12-13-8-10-4-2-3-7-16(10)12/h5-6,9-10H,2-4,7-8H2,1H3,(H,13,15)/t9?,10-/m1/s1 |
| InChIKey | YVAMCJHPBMBHPB-QVDQXJPCSA-N |
| XLogP | 2.02 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |