C16H19F3N2O — CID 166265437
1,1,1-trifluoro-3-[4-(1H-indol-5-yl)piperidin-1-yl]propan-2-ol (PubChem CID 166265437) has the molecular formula C16H19F3N2O and a molecular weight of 312.33 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[4-(1H-indol-5-yl)piperidin-1-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[4-(1H-indol-5-yl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 166265437 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1,1,1-trifluoro-3-[4-(1H-indol-5-yl)piperidin-1-yl]propan-2-ol |
| SMILES | OC(CN1CCC(c2ccc3[nH]ccc3c2)CC1)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O/c17-16(18,19)15(22)10-21-7-4-11(5-8-21)12-1-2-14-13(9-12)3-6-20-14/h1-3,6,9,11,15,20,22H,4-5,7-8,10H2 |
| InChIKey | CJFHCAAPSDTNGO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |