C15H16F3N5O3S2 — CID 166266951
7-[2-(dimethylamino)ethylsulfanyl]-2-thiophen-2-yl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one;2,2,2-trifluoroacetic acid (PubChem CID 166266951) has the molecular formula C15H16F3N5O3S2 and a molecular weight of 435.45 g/mol. Its IUPAC name is 7-[2-(dimethylamino)ethylsulfanyl]-2-thiophen-2-yl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-[2-(dimethylamino)ethylsulfanyl]-2-thiophen-2-yl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166266951 |
| Molecular Formula | C15H16F3N5O3S2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 7-[2-(dimethylamino)ethylsulfanyl]-2-thiophen-2-yl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCSc1n[nH]c(=O)c2cc(-c3cccs3)nn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H15N5OS2.C2HF3O2/c1-17(2)5-7-21-13-15-14-12(19)10-8-9(16-18(10)13)11-4-3-6-20-11;3-2(4,5)1(6)7/h3-4,6,8H,5,7H2,1-2H3,(H,14,19);(H,6,7) |
| InChIKey | MZHHZNUGMAPUIA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |