C12H17N3O4S2 — CID 166267031
(3aR)-2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-3-one (PubChem CID 166267031) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3aR)-2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-3-one.
| Compound Name | (3aR)-2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-3-one |
|---|---|
| PubChem CID | 166267031 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (3aR)-2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-3-one |
| SMILES | COC(C)c1nc(CN2C(=O)[C@H]3CCCN3S2(=O)=O)cs1 |
| InChI | InChI=1S/C12H17N3O4S2/c1-8(19-2)11-13-9(7-20-11)6-15-12(16)10-4-3-5-14(10)21(15,17)18/h7-8,10H,3-6H2,1-2H3/t8?,10-/m1/s1 |
| InChIKey | JVGIFTHXAZTUIE-LHIURRSHSA-N |
| XLogP | 0.90 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |