C18H19F2NO3 — CID 166267667
2-(2,5-difluorophenyl)-2-[(2-hydroxy-5-propan-2-ylphenyl)methylamino]acetic acid (PubChem CID 166267667) has the molecular formula C18H19F2NO3 and a molecular weight of 335.35 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-2-[(2-hydroxy-5-propan-2-ylphenyl)methylamino]acetic acid.
| Compound Name | 2-(2,5-difluorophenyl)-2-[(2-hydroxy-5-propan-2-ylphenyl)methylamino]acetic acid |
|---|---|
| PubChem CID | 166267667 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-(2,5-difluorophenyl)-2-[(2-hydroxy-5-propan-2-ylphenyl)methylamino]acetic acid |
| SMILES | CC(C)c1ccc(O)c(CNC(C(=O)O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C18H19F2NO3/c1-10(2)11-3-6-16(22)12(7-11)9-21-17(18(23)24)14-8-13(19)4-5-15(14)20/h3-8,10,17,21-22H,9H2,1-2H3,(H,23,24) |
| InChIKey | COWRNAODLMPHQZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|