About 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid
4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid (PubChem CID 166268010) has the molecular formula C18H22N2O2S
and a molecular weight of 330.45 g/mol. Its IUPAC name is 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid |
| PubChem CID | 166268010 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid |
| SMILES | C=CCCC1(C(=O)O)CCN(Cc2cc3ccncc3s2)CC1 |
| InChI | InChI=1S/C18H22N2O2S/c1-2-3-5-18(17(21)22)6-9-20(10-7-18)13-15-11-14-4-8-19-12-16(14)23-15/h2,4,8,11-12H,1,3,5-7,9-10,13H2,(H,21,22) |
| InChIKey | URXIEDLEGIRVMX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid?
The IUPAC name of 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid (CID 166268010) is 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid.
What is the SMILES notation for 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid?
The canonical SMILES for 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid is C=CCCC1(C(=O)O)CCN(Cc2cc3ccncc3s2)CC1.
What is the InChIKey of 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid?
The InChIKey is URXIEDLEGIRVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2S/c1-2-3-5-18(17(21)22)6-9-20(10-7-18)13-15-11-14-4-8-19-12-16(14)23-15/h2,4,8,11-12H,1,3,5-7,9-10,13H2,(H,21,22).
What are the key properties of 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid?
4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid has a molecular weight of 330.45 g/mol, XLogP of 3.93, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enyl-1-(thieno[2,3-c]pyridin-2-ylmethyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 166268010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).