C18H19N3O3 — CID 166268202
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 166268202) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 166268202 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | Cc1nc(CN2CCc3[nH]c4ccc(C(=O)O)cc4c3C2)oc1C |
| InChI | InChI=1S/C18H19N3O3/c1-10-11(2)24-17(19-10)9-21-6-5-16-14(8-21)13-7-12(18(22)23)3-4-15(13)20-16/h3-4,7,20H,5-6,8-9H2,1-2H3,(H,22,23) |
| InChIKey | SBARKYLHGRVRED-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|