C18H19FN4O2 — CID 166268204
2-[[1-(2-fluoroethyl)pyrazol-3-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 166268204) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 2-[[1-(2-fluoroethyl)pyrazol-3-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | 2-[[1-(2-fluoroethyl)pyrazol-3-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 166268204 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[[1-(2-fluoroethyl)pyrazol-3-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]c3c(c2c1)CN(Cc1ccn(CCF)n1)CC3 |
| InChI | InChI=1S/C18H19FN4O2/c19-5-8-23-7-3-13(21-23)10-22-6-4-17-15(11-22)14-9-12(18(24)25)1-2-16(14)20-17/h1-3,7,9,20H,4-6,8,10-11H2,(H,24,25) |
| InChIKey | NURUDRXINVUNDY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|