About (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone
(1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone (PubChem CID 166268517) has the molecular formula C18H22N4OS
and a molecular weight of 342.47 g/mol. Its IUPAC name is (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone |
| PubChem CID | 166268517 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone |
| SMILES | CC(c1ccsc1)N1CCN(C(=O)c2cc3c(ccn3C)[nH]2)CC1 |
| InChI | InChI=1S/C18H22N4OS/c1-13(14-4-10-24-12-14)21-6-8-22(9-7-21)18(23)16-11-17-15(19-16)3-5-20(17)2/h3-5,10-13,19H,6-9H2,1-2H3 |
| InChIKey | PNMJFUBOOFWEKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone?
The IUPAC name of (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone (CID 166268517) is (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone.
What is the SMILES notation for (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone?
The canonical SMILES for (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone is CC(c1ccsc1)N1CCN(C(=O)c2cc3c(ccn3C)[nH]2)CC1.
What is the InChIKey of (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone?
The InChIKey is PNMJFUBOOFWEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4OS/c1-13(14-4-10-24-12-14)21-6-8-22(9-7-21)18(23)16-11-17-15(19-16)3-5-20(17)2/h3-5,10-13,19H,6-9H2,1-2H3.
What are the key properties of (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone?
(1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone has a molecular weight of 342.47 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-4H-pyrrolo[3,2-b]pyrrol-5-yl)-[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methanone is sourced from PubChem (CID 166268517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).