C19H31N3O3 — CID 166269993
1-[(3aR,8aS)-7,7-dimethyl-3,3a,4,6,8,8a-hexahydro-2H-furo[3,2-c]azepin-5-yl]-2-[(3S,4R)-3-amino-4-cyclopropylpyrrolidin-1-yl]ethane-1,2-dione (PubChem CID 166269993) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[(3aR,8aS)-7,7-dimethyl-3,3a,4,6,8,8a-hexahydro-2H-furo[3,2-c]azepin-5-yl]-2-[(3S,4R)-3-amino-4-cyclopropylpyrrolidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[(3aR,8aS)-7,7-dimethyl-3,3a,4,6,8,8a-hexahydro-2H-furo[3,2-c]azepin-5-yl]-2-[(3S,4R)-3-amino-4-cyclopropylpyrrolidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 166269993 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 1-[(3aR,8aS)-7,7-dimethyl-3,3a,4,6,8,8a-hexahydro-2H-furo[3,2-c]azepin-5-yl]-2-[(3S,4R)-3-amino-4-cyclopropylpyrrolidin-1-yl]ethane-1,2-dione |
| SMILES | CC1(C)C[C@@H]2OCC[C@@H]2CN(C(=O)C(=O)N2C[C@@H](N)[C@H](C3CC3)C2)C1 |
| InChI | InChI=1S/C19H31N3O3/c1-19(2)7-16-13(5-6-25-16)8-22(11-19)18(24)17(23)21-9-14(12-3-4-12)15(20)10-21/h12-16H,3-11,20H2,1-2H3/t13-,14+,15-,16+/m1/s1 |
| InChIKey | JMALNXSUAAIXKC-QXSJWSMHSA-N |
| XLogP | 0.85 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|