C19H21N3O — CID 166270067
2,6-dimethyl-N-[3-(1H-pyrazol-4-yl)propyl]naphthalene-1-carboxamide (PubChem CID 166270067) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 2,6-dimethyl-N-[3-(1H-pyrazol-4-yl)propyl]naphthalene-1-carboxamide.
| Compound Name | 2,6-dimethyl-N-[3-(1H-pyrazol-4-yl)propyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 166270067 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2,6-dimethyl-N-[3-(1H-pyrazol-4-yl)propyl]naphthalene-1-carboxamide |
| SMILES | Cc1ccc2c(C(=O)NCCCc3cn[nH]c3)c(C)ccc2c1 |
| InChI | InChI=1S/C19H21N3O/c1-13-5-8-17-16(10-13)7-6-14(2)18(17)19(23)20-9-3-4-15-11-21-22-12-15/h5-8,10-12H,3-4,9H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | SJMPLGUWNXWCSK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|