About N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide
N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide (PubChem CID 166270302) has the molecular formula C17H27F3N2O
and a molecular weight of 332.41 g/mol. Its IUPAC name is N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide.
Molecular Properties
| Compound Name | N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide |
| PubChem CID | 166270302 |
| Molecular Formula | C17H27F3N2O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(NC(C1CCCC1)C(F)(F)F)C1CCC2(CCNC2)CC1 |
| InChI | InChI=1S/C17H27F3N2O/c18-17(19,20)14(12-3-1-2-4-12)22-15(23)13-5-7-16(8-6-13)9-10-21-11-16/h12-14,21H,1-11H2,(H,22,23) |
| InChIKey | CPRCHQVMRONCRX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide?
The IUPAC name of N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide (CID 166270302) is N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide.
What is the SMILES notation for N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide?
The canonical SMILES for N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide is O=C(NC(C1CCCC1)C(F)(F)F)C1CCC2(CCNC2)CC1.
What is the InChIKey of N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide?
The InChIKey is CPRCHQVMRONCRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27F3N2O/c18-17(19,20)14(12-3-1-2-4-12)22-15(23)13-5-7-16(8-6-13)9-10-21-11-16/h12-14,21H,1-11H2,(H,22,23).
What are the key properties of N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide?
N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide has a molecular weight of 332.41 g/mol, XLogP of 3.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopentyl-2,2,2-trifluoroethyl)-2-azaspiro[4.5]decane-8-carboxamide is sourced from PubChem (CID 166270302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).