C21H31NO4 — CID 166271358
methyl 4-[1-[(5-methoxy-2-methylphenyl)methyl]piperidin-4-yl]oxane-4-carboxylate (PubChem CID 166271358) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is methyl 4-[1-[(5-methoxy-2-methylphenyl)methyl]piperidin-4-yl]oxane-4-carboxylate.
| Compound Name | methyl 4-[1-[(5-methoxy-2-methylphenyl)methyl]piperidin-4-yl]oxane-4-carboxylate |
|---|---|
| PubChem CID | 166271358 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | methyl 4-[1-[(5-methoxy-2-methylphenyl)methyl]piperidin-4-yl]oxane-4-carboxylate |
| SMILES | COC(=O)C1(C2CCN(Cc3cc(OC)ccc3C)CC2)CCOCC1 |
| InChI | InChI=1S/C21H31NO4/c1-16-4-5-19(24-2)14-17(16)15-22-10-6-18(7-11-22)21(20(23)25-3)8-12-26-13-9-21/h4-5,14,18H,6-13,15H2,1-3H3 |
| InChIKey | UWPICSUFJCUOOP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |