C11H16N4O2 — CID 166271466
1-(2,5-dihydropyrrol-1-yl)-2-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)amino]ethanone (PubChem CID 166271466) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 1-(2,5-dihydropyrrol-1-yl)-2-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)amino]ethanone.
| Compound Name | 1-(2,5-dihydropyrrol-1-yl)-2-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)amino]ethanone |
|---|---|
| PubChem CID | 166271466 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(2,5-dihydropyrrol-1-yl)-2-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)amino]ethanone |
| SMILES | CC(C)c1noc(NCC(=O)N2CC=CC2)n1 |
| InChI | InChI=1S/C11H16N4O2/c1-8(2)10-13-11(17-14-10)12-7-9(16)15-5-3-4-6-15/h3-4,8H,5-7H2,1-2H3,(H,12,13,14) |
| InChIKey | FSDCQEDCFNJVIV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|