C15H15NO3S2 — CID 166272039
(1S,5R)-5-[(2-methylthieno[3,2-b]thiophene-5-carbonyl)amino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 166272039) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (1S,5R)-5-[(2-methylthieno[3,2-b]thiophene-5-carbonyl)amino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,5R)-5-[(2-methylthieno[3,2-b]thiophene-5-carbonyl)amino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 166272039 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (1S,5R)-5-[(2-methylthieno[3,2-b]thiophene-5-carbonyl)amino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1cc2sc(C(=O)N[C@H]3C=CC[C@H](C(=O)O)C3)cc2s1 |
| InChI | InChI=1S/C15H15NO3S2/c1-8-5-11-12(20-8)7-13(21-11)14(17)16-10-4-2-3-9(6-10)15(18)19/h2,4-5,7,9-10H,3,6H2,1H3,(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | QJURMPPUOHLLFO-UWVGGRQHSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|