About (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone
(6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 166272761) has the molecular formula C18H14BrF2N3O
and a molecular weight of 406.23 g/mol. Its IUPAC name is (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone.
Molecular Properties
| Compound Name | (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
| PubChem CID | 166272761 |
| Molecular Formula | C18H14BrF2N3O |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | Cn1nc2cc(Br)ccc2c1C(=O)N1CCCc2c(F)ccc(F)c21 |
| InChI | InChI=1S/C18H14BrF2N3O/c1-23-17(12-5-4-10(19)9-15(12)22-23)18(25)24-8-2-3-11-13(20)6-7-14(21)16(11)24/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | IIKXNMIGMUAQLV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone?
The IUPAC name of (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone (CID 166272761) is (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone.
What is the SMILES notation for (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone?
The canonical SMILES for (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone is Cn1nc2cc(Br)ccc2c1C(=O)N1CCCc2c(F)ccc(F)c21.
What is the InChIKey of (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone?
The InChIKey is IIKXNMIGMUAQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrF2N3O/c1-23-17(12-5-4-10(19)9-15(12)22-23)18(25)24-8-2-3-11-13(20)6-7-14(21)16(11)24/h4-7,9H,2-3,8H2,1H3.
What are the key properties of (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone?
(6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone has a molecular weight of 406.23 g/mol, XLogP of 4.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2-methylindazol-3-yl)-(5,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone is sourced from PubChem (CID 166272761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).