About N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine
N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine (PubChem CID 166272898) has the molecular formula C18H13F2N5O
and a molecular weight of 353.33 g/mol. Its IUPAC name is N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine.
Molecular Properties
| Compound Name | N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine |
| PubChem CID | 166272898 |
| Molecular Formula | C18H13F2N5O |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine |
| SMILES | Fc1ccccc1-c1nc(CNc2ccn(-c3ncccc3F)n2)co1 |
| InChI | InChI=1S/C18H13F2N5O/c19-14-5-2-1-4-13(14)18-23-12(11-26-18)10-22-16-7-9-25(24-16)17-15(20)6-3-8-21-17/h1-9,11H,10H2,(H,22,24) |
| InChIKey | OJZFYJLSTLYQQM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine?
The IUPAC name of N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine (CID 166272898) is N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine.
What is the SMILES notation for N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine?
The canonical SMILES for N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine is Fc1ccccc1-c1nc(CNc2ccn(-c3ncccc3F)n2)co1.
What is the InChIKey of N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine?
The InChIKey is OJZFYJLSTLYQQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2N5O/c19-14-5-2-1-4-13(14)18-23-12(11-26-18)10-22-16-7-9-25(24-16)17-15(20)6-3-8-21-17/h1-9,11H,10H2,(H,22,24).
What are the key properties of N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine?
N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine has a molecular weight of 353.33 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluoro-2-pyridinyl)pyrazol-3-amine is sourced from PubChem (CID 166272898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).