About 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole
2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole (PubChem CID 166273321) has the molecular formula C10H7N3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole |
| PubChem CID | 166273321 |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole |
| SMILES | c1cc2[nH]cc(-c3nccs3)c2cn1 |
| InChI | InChI=1S/C10H7N3S/c1-2-11-5-7-8(6-13-9(1)7)10-12-3-4-14-10/h1-6,13H |
| InChIKey | VMRZAPVXALBRNY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole?
The IUPAC name of 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole (CID 166273321) is 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole.
What is the SMILES notation for 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole?
The canonical SMILES for 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole is c1cc2[nH]cc(-c3nccs3)c2cn1.
What is the InChIKey of 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole?
The InChIKey is VMRZAPVXALBRNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3S/c1-2-11-5-7-8(6-13-9(1)7)10-12-3-4-14-10/h1-6,13H.
What are the key properties of 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole?
2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole has a molecular weight of 201.25 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)-1,3-thiazole is sourced from PubChem (CID 166273321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).