About 4-naphthalen-1-yl-1,6-naphthyridine
4-naphthalen-1-yl-1,6-naphthyridine (PubChem CID 166273330) has the molecular formula C18H12N2
and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-naphthalen-1-yl-1,6-naphthyridine.
Molecular Properties
| Compound Name | 4-naphthalen-1-yl-1,6-naphthyridine |
| PubChem CID | 166273330 |
| Molecular Formula | C18H12N2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-naphthalen-1-yl-1,6-naphthyridine |
| SMILES | c1ccc2c(-c3ccnc4ccncc34)cccc2c1 |
| InChI | InChI=1S/C18H12N2/c1-2-6-14-13(4-1)5-3-7-15(14)16-8-11-20-18-9-10-19-12-17(16)18/h1-12H |
| InChIKey | WPDLWMBXODRYPG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-naphthalen-1-yl-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-naphthalen-1-yl-1,6-naphthyridine?
The IUPAC name of 4-naphthalen-1-yl-1,6-naphthyridine (CID 166273330) is 4-naphthalen-1-yl-1,6-naphthyridine.
What is the SMILES notation for 4-naphthalen-1-yl-1,6-naphthyridine?
The canonical SMILES for 4-naphthalen-1-yl-1,6-naphthyridine is c1ccc2c(-c3ccnc4ccncc34)cccc2c1.
What is the InChIKey of 4-naphthalen-1-yl-1,6-naphthyridine?
The InChIKey is WPDLWMBXODRYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2/c1-2-6-14-13(4-1)5-3-7-15(14)16-8-11-20-18-9-10-19-12-17(16)18/h1-12H.
What are the key properties of 4-naphthalen-1-yl-1,6-naphthyridine?
4-naphthalen-1-yl-1,6-naphthyridine has a molecular weight of 256.31 g/mol, XLogP of 4.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-naphthalen-1-yl-1,6-naphthyridine is sourced from PubChem (CID 166273330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).