About 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid
3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid (PubChem CID 166273636) has the molecular formula C12H20F2N2O5S
and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid |
| PubChem CID | 166273636 |
| Molecular Formula | C12H20F2N2O5S |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid |
| SMILES | COC1(CNS(=O)(=O)N2CCC(F)(F)CC2)CC(C(=O)O)C1 |
| InChI | InChI=1S/C12H20F2N2O5S/c1-21-11(6-9(7-11)10(17)18)8-15-22(19,20)16-4-2-12(13,14)3-5-16/h9,15H,2-8H2,1H3,(H,17,18) |
| InChIKey | JRYZDXWNMCLJOL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid?
The IUPAC name of 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid (CID 166273636) is 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid.
What is the SMILES notation for 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid?
The canonical SMILES for 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid is COC1(CNS(=O)(=O)N2CCC(F)(F)CC2)CC(C(=O)O)C1.
What is the InChIKey of 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid?
The InChIKey is JRYZDXWNMCLJOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2N2O5S/c1-21-11(6-9(7-11)10(17)18)8-15-22(19,20)16-4-2-12(13,14)3-5-16/h9,15H,2-8H2,1H3,(H,17,18).
What are the key properties of 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid?
3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid has a molecular weight of 342.36 g/mol, XLogP of 0.43, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(4,4-difluoropiperidin-1-yl)sulfonylamino]methyl]-3-methoxycyclobutane-1-carboxylic acid is sourced from PubChem (CID 166273636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).