About 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine
4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine (PubChem CID 166274514) has the molecular formula C16H22F3N3O
and a molecular weight of 329.37 g/mol. Its IUPAC name is 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine |
| PubChem CID | 166274514 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine |
| SMILES | FC(F)(F)[C@@H]1CC=CC[C@H]1Cn1ccnc1CN1CCOCC1 |
| InChI | InChI=1S/C16H22F3N3O/c17-16(18,19)14-4-2-1-3-13(14)11-22-6-5-20-15(22)12-21-7-9-23-10-8-21/h1-2,5-6,13-14H,3-4,7-12H2/t13-,14+/m0/s1 |
| InChIKey | HZCFSAMBTDPHNZ-UONOGXRCSA-N |
| XLogP | 2.86 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine?
The IUPAC name of 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine (CID 166274514) is 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine is FC(F)(F)[C@@H]1CC=CC[C@H]1Cn1ccnc1CN1CCOCC1.
What is the InChIKey of 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine?
The InChIKey is HZCFSAMBTDPHNZ-UONOGXRCSA-N. The full InChI is InChI=1S/C16H22F3N3O/c17-16(18,19)14-4-2-1-3-13(14)11-22-6-5-20-15(22)12-21-7-9-23-10-8-21/h1-2,5-6,13-14H,3-4,7-12H2/t13-,14+/m0/s1.
What are the key properties of 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine?
4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine has a molecular weight of 329.37 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-[[(1R,6R)-6-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]imidazol-2-yl]methyl]morpholine is sourced from PubChem (CID 166274514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).