About 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one
3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one (PubChem CID 166274647) has the molecular formula C15H17N5O4
and a molecular weight of 331.33 g/mol. Its IUPAC name is 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one |
| PubChem CID | 166274647 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc(Cn3nnn(C4CCOCC4)c3=O)cc21 |
| InChI | InChI=1S/C15H17N5O4/c1-18-12-8-10(2-3-13(12)24-15(18)22)9-19-14(21)20(17-16-19)11-4-6-23-7-5-11/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | ZVUBDHGJYXDMDH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 97.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one?
The IUPAC name of 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one (CID 166274647) is 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one?
The canonical SMILES for 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one is Cn1c(=O)oc2ccc(Cn3nnn(C4CCOCC4)c3=O)cc21.
What is the InChIKey of 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one?
The InChIKey is ZVUBDHGJYXDMDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O4/c1-18-12-8-10(2-3-13(12)24-15(18)22)9-19-14(21)20(17-16-19)11-4-6-23-7-5-11/h2-3,8,11H,4-7,9H2,1H3.
What are the key properties of 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one?
3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one has a molecular weight of 331.33 g/mol, XLogP of 0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[[4-(oxan-4-yl)-5-oxotetrazol-1-yl]methyl]-1,3-benzoxazol-2-one is sourced from PubChem (CID 166274647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).