C15H21N3 — CID 166275170
N-[(1S,4S)-2-bicyclo[2.2.2]oct-5-enyl]-4,5,6,7-tetrahydro-1H-indazol-6-amine (PubChem CID 166275170) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[(1S,4S)-2-bicyclo[2.2.2]oct-5-enyl]-4,5,6,7-tetrahydro-1H-indazol-6-amine.
| Compound Name | N-[(1S,4S)-2-bicyclo[2.2.2]oct-5-enyl]-4,5,6,7-tetrahydro-1H-indazol-6-amine |
|---|---|
| PubChem CID | 166275170 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-[(1S,4S)-2-bicyclo[2.2.2]oct-5-enyl]-4,5,6,7-tetrahydro-1H-indazol-6-amine |
| SMILES | C1=C[C@@H]2CC[C@H]1CC2NC1CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C15H21N3/c1-3-11-4-2-10(1)7-14(11)17-13-6-5-12-9-16-18-15(12)8-13/h1,3,9-11,13-14,17H,2,4-8H2,(H,16,18)/t10-,11+,13?,14?/m0/s1 |
| InChIKey | NVNIBVKMTBYAST-YWBBTBBSSA-N |
| XLogP | 2.21 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|