C17H22N2O4 — CID 166275620
2-[(5-methoxy-3-pyridinyl)methyl-methylcarbamoyl]spiro[3.3]heptane-2-carboxylic acid (PubChem CID 166275620) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[(5-methoxy-3-pyridinyl)methyl-methylcarbamoyl]spiro[3.3]heptane-2-carboxylic acid.
| Compound Name | 2-[(5-methoxy-3-pyridinyl)methyl-methylcarbamoyl]spiro[3.3]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 166275620 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-[(5-methoxy-3-pyridinyl)methyl-methylcarbamoyl]spiro[3.3]heptane-2-carboxylic acid |
| SMILES | COc1cncc(CN(C)C(=O)C2(C(=O)O)CC3(CCC3)C2)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-19(9-12-6-13(23-2)8-18-7-12)14(20)17(15(21)22)10-16(11-17)4-3-5-16/h6-8H,3-5,9-11H2,1-2H3,(H,21,22) |
| InChIKey | CKBMLENHIBQXIZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|