About 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide
3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide (PubChem CID 166276401) has the molecular formula C18H24N4O2
and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide |
| PubChem CID | 166276401 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide |
| SMILES | COC1(CN)CC(C(=O)Nc2cnn(-c3ccc(C)cc3C)c2)C1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-4-5-16(13(2)6-12)22-10-15(9-20-22)21-17(23)14-7-18(8-14,11-19)24-3/h4-6,9-10,14H,7-8,11,19H2,1-3H3,(H,21,23) |
| InChIKey | OJENIIWJNVRPAT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide?
The IUPAC name of 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide (CID 166276401) is 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide.
What is the SMILES notation for 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide?
The canonical SMILES for 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide is COC1(CN)CC(C(=O)Nc2cnn(-c3ccc(C)cc3C)c2)C1.
What is the InChIKey of 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide?
The InChIKey is OJENIIWJNVRPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2/c1-12-4-5-16(13(2)6-12)22-10-15(9-20-22)21-17(23)14-7-18(8-14,11-19)24-3/h4-6,9-10,14H,7-8,11,19H2,1-3H3,(H,21,23).
What are the key properties of 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide?
3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide has a molecular weight of 328.42 g/mol, XLogP of 2.18, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N-[1-(2,4-dimethylphenyl)pyrazol-4-yl]-3-methoxycyclobutane-1-carboxamide is sourced from PubChem (CID 166276401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).