C21H26N2O5 — CID 166277084
4-[[[2-[3-(3-methoxyphenyl)-2,5-dihydropyrrol-1-yl]-2-oxoacetyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 166277084) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[[[2-[3-(3-methoxyphenyl)-2,5-dihydropyrrol-1-yl]-2-oxoacetyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[2-[3-(3-methoxyphenyl)-2,5-dihydropyrrol-1-yl]-2-oxoacetyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166277084 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-[[[2-[3-(3-methoxyphenyl)-2,5-dihydropyrrol-1-yl]-2-oxoacetyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | COc1cccc(C2=CCN(C(=O)C(=O)NCC3CCC(C(=O)O)CC3)C2)c1 |
| InChI | InChI=1S/C21H26N2O5/c1-28-18-4-2-3-16(11-18)17-9-10-23(13-17)20(25)19(24)22-12-14-5-7-15(8-6-14)21(26)27/h2-4,9,11,14-15H,5-8,10,12-13H2,1H3,(H,22,24)(H,26,27) |
| InChIKey | HBVPPXWNCSUBJE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|