C16H20N2O4S — CID 166277113
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 166277113) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 166277113 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1(C)CCc2cc(C(=O)NC3C=CS(=O)(=O)C3)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C16H20N2O4S/c1-16(2)5-3-10-7-12(15(20)18-13(10)8-16)14(19)17-11-4-6-23(21,22)9-11/h4,6-7,11H,3,5,8-9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | KIYIFPBOZVSLOD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |