C15H22F3N3O3 — CID 166280533
(2S)-N-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]-4-methyl-2-(3,3,3-trifluoropropanoylamino)pentanamide (PubChem CID 166280533) has the molecular formula C15H22F3N3O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is (2S)-N-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]-4-methyl-2-(3,3,3-trifluoropropanoylamino)pentanamide.
| Compound Name | (2S)-N-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]-4-methyl-2-(3,3,3-trifluoropropanoylamino)pentanamide |
|---|---|
| PubChem CID | 166280533 |
| Molecular Formula | C15H22F3N3O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2S)-N-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]-4-methyl-2-(3,3,3-trifluoropropanoylamino)pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)CC(F)(F)F)C(=O)NCC(=O)N1CC=CC1 |
| InChI | InChI=1S/C15H22F3N3O3/c1-10(2)7-11(20-12(22)8-15(16,17)18)14(24)19-9-13(23)21-5-3-4-6-21/h3-4,10-11H,5-9H2,1-2H3,(H,19,24)(H,20,22)/t11-/m0/s1 |
| InChIKey | HCGCFXYPJYKURH-NSHDSACASA-N |
| XLogP | 0.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|