C13H22N2O3S — CID 166281371
N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-2-sulfamoylpropanamide (PubChem CID 166281371) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-2-sulfamoylpropanamide.
| Compound Name | N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-2-sulfamoylpropanamide |
|---|---|
| PubChem CID | 166281371 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-2-sulfamoylpropanamide |
| SMILES | C=C1C(NC(=O)C(C)S(N)(=O)=O)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C13H22N2O3S/c1-7-10-5-9(13(10,3)4)6-11(7)15-12(16)8(2)19(14,17)18/h8-11H,1,5-6H2,2-4H3,(H,15,16)(H2,14,17,18)/t8?,9-,10+,11?/m1/s1 |
| InChIKey | BNFKOBOAWHOKRC-WIFZPCQCSA-N |
| XLogP | 0.77 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|