C17H28N2O3S — CID 166281376
N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-4-sulfamoylcyclohexane-1-carboxamide (PubChem CID 166281376) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-4-sulfamoylcyclohexane-1-carboxamide.
| Compound Name | N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-4-sulfamoylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166281376 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-4-sulfamoylcyclohexane-1-carboxamide |
| SMILES | C=C1C(NC(=O)C2CCC(S(N)(=O)=O)CC2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C17H28N2O3S/c1-10-14-8-12(17(14,2)3)9-15(10)19-16(20)11-4-6-13(7-5-11)23(18,21)22/h11-15H,1,4-9H2,2-3H3,(H,19,20)(H2,18,21,22)/t11?,12-,13?,14+,15?/m1/s1 |
| InChIKey | BUDBEABIQWDZSJ-MFEYBKIZSA-N |
| XLogP | 1.94 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|