About 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol
3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol (PubChem CID 166282059) has the molecular formula C10H15N5O
and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol.
Molecular Properties
| Compound Name | 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol |
| PubChem CID | 166282059 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol |
| SMILES | Nc1ncnc(N2CC3CC(O)C(C3)C2)n1 |
| InChI | InChI=1S/C10H15N5O/c11-9-12-5-13-10(14-9)15-3-6-1-7(4-15)8(16)2-6/h5-8,16H,1-4H2,(H2,11,12,13,14) |
| InChIKey | WXGRZUOFRNYTLW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol?
The IUPAC name of 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol (CID 166282059) is 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol.
What is the SMILES notation for 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol?
The canonical SMILES for 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol is Nc1ncnc(N2CC3CC(O)C(C3)C2)n1.
What is the InChIKey of 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol?
The InChIKey is WXGRZUOFRNYTLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O/c11-9-12-5-13-10(14-9)15-3-6-1-7(4-15)8(16)2-6/h5-8,16H,1-4H2,(H2,11,12,13,14).
What are the key properties of 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol?
3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol has a molecular weight of 221.26 g/mol, XLogP of -0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-1,3,5-triazin-2-yl)-3-azabicyclo[3.2.1]octan-6-ol is sourced from PubChem (CID 166282059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).