About [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol
[3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol (PubChem CID 166282402) has the molecular formula C16H31NO3S
and a molecular weight of 317.50 g/mol. Its IUPAC name is [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol |
| PubChem CID | 166282402 |
| Molecular Formula | C16H31NO3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol |
| SMILES | CC1CC(C)(CS(=O)(=O)N2CCC(CO)(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C16H31NO3S/c1-13-8-15(5,9-13)12-21(19,20)17-7-6-16(10-17,11-18)14(2,3)4/h13,18H,6-12H2,1-5H3 |
| InChIKey | GQPUNLRZDTWWJJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol?
The IUPAC name of [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol (CID 166282402) is [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol.
What is the SMILES notation for [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol?
The canonical SMILES for [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol is CC1CC(C)(CS(=O)(=O)N2CCC(CO)(C(C)(C)C)C2)C1.
What is the InChIKey of [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol?
The InChIKey is GQPUNLRZDTWWJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO3S/c1-13-8-15(5,9-13)12-21(19,20)17-7-6-16(10-17,11-18)14(2,3)4/h13,18H,6-12H2,1-5H3.
What are the key properties of [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol?
[3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol has a molecular weight of 317.50 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-tert-butyl-1-[(1,3-dimethylcyclobutyl)methylsulfonyl]pyrrolidin-3-yl]methanol is sourced from PubChem (CID 166282402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).