C18H24FNO3 — CID 166282479
1-[3-(4-fluoro-3-methoxyphenyl)azetidin-1-yl]-3-(3-methoxycyclobutyl)propan-1-one (PubChem CID 166282479) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is 1-[3-(4-fluoro-3-methoxyphenyl)azetidin-1-yl]-3-(3-methoxycyclobutyl)propan-1-one.
| Compound Name | 1-[3-(4-fluoro-3-methoxyphenyl)azetidin-1-yl]-3-(3-methoxycyclobutyl)propan-1-one |
|---|---|
| PubChem CID | 166282479 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[3-(4-fluoro-3-methoxyphenyl)azetidin-1-yl]-3-(3-methoxycyclobutyl)propan-1-one |
| SMILES | COc1cc(C2CN(C(=O)CCC3CC(OC)C3)C2)ccc1F |
| InChI | InChI=1S/C18H24FNO3/c1-22-15-7-12(8-15)3-6-18(21)20-10-14(11-20)13-4-5-16(19)17(9-13)23-2/h4-5,9,12,14-15H,3,6-8,10-11H2,1-2H3 |
| InChIKey | ZWYAZGOSBNAEAG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |