C14H11F4NO4 — CID 166282652
[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)methanone (PubChem CID 166282652) has the molecular formula C14H11F4NO4 and a molecular weight of 333.24 g/mol. Its IUPAC name is [(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)methanone.
| Compound Name | [(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 166282652 |
| Molecular Formula | C14H11F4NO4 |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)methanone |
| SMILES | Cc1oc2c(F)c(F)c(F)c(F)c2c1C(=O)N1C[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C14H11F4NO4/c1-4-7(14(22)19-2-5(20)6(21)3-19)8-9(15)10(16)11(17)12(18)13(8)23-4/h5-6,20-21H,2-3H2,1H3/t5-,6-/m1/s1 |
| InChIKey | XVJCXRUJQMIXRA-PHDIDXHHSA-N |
| XLogP | 1.48 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|