C20H20N2O3 — CID 166282905
2-[(E)-2-[2-(piperidine-1-carbonyl)phenyl]ethenyl]pyridine-4-carboxylic acid (PubChem CID 166282905) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[(E)-2-[2-(piperidine-1-carbonyl)phenyl]ethenyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(E)-2-[2-(piperidine-1-carbonyl)phenyl]ethenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 166282905 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[(E)-2-[2-(piperidine-1-carbonyl)phenyl]ethenyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(/C=C/c2ccccc2C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H20N2O3/c23-19(22-12-4-1-5-13-22)18-7-3-2-6-15(18)8-9-17-14-16(20(24)25)10-11-21-17/h2-3,6-11,14H,1,4-5,12-13H2,(H,24,25)/b9-8+ |
| InChIKey | ACWBSZXSFVKYFK-CMDGGOBGSA-N |
| XLogP | 3.58 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |