C11H11F3N2O2S — CID 166282932
1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid (PubChem CID 166282932) has the molecular formula C11H11F3N2O2S and a molecular weight of 292.28 g/mol. Its IUPAC name is 1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 166282932 |
| Molecular Formula | C11H11F3N2O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)C1C=CCN(Cc2cnc(C(F)(F)F)s2)C1 |
| InChI | InChI=1S/C11H11F3N2O2S/c12-11(13,14)10-15-4-8(19-10)6-16-3-1-2-7(5-16)9(17)18/h1-2,4,7H,3,5-6H2,(H,17,18) |
| InChIKey | VWUPTCHABBAPPJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|