C16H26N2O2 — CID 166283098
2-ethyl-2-(hydroxymethyl)-N'-(4-propylphenyl)butanehydrazide (PubChem CID 166283098) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)-N'-(4-propylphenyl)butanehydrazide.
| Compound Name | 2-ethyl-2-(hydroxymethyl)-N'-(4-propylphenyl)butanehydrazide |
|---|---|
| PubChem CID | 166283098 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)-N'-(4-propylphenyl)butanehydrazide |
| SMILES | CCCc1ccc(NNC(=O)C(CC)(CC)CO)cc1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-7-13-8-10-14(11-9-13)17-18-15(20)16(5-2,6-3)12-19/h8-11,17,19H,4-7,12H2,1-3H3,(H,18,20) |
| InChIKey | SXSBLCBZNUXCES-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|