C16H22F3N3O — CID 166283178
(E,1R,4R)-1,7,7-trimethyl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methoxy]bicyclo[2.2.1]heptan-2-imine (PubChem CID 166283178) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is (E,1R,4R)-1,7,7-trimethyl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methoxy]bicyclo[2.2.1]heptan-2-imine.
| Compound Name | (E,1R,4R)-1,7,7-trimethyl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methoxy]bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 166283178 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (E,1R,4R)-1,7,7-trimethyl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methoxy]bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/OCc1nccn1CC(F)(F)F)C2 |
| InChI | InChI=1S/C16H22F3N3O/c1-14(2)11-4-5-15(14,3)12(8-11)21-23-9-13-20-6-7-22(13)10-16(17,18)19/h6-7,11H,4-5,8-10H2,1-3H3/b21-12+/t11-,15+/m1/s1 |
| InChIKey | MYXZACPQOKKFCT-KZTFVTMDSA-N |
| XLogP | 4.16 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|