C15H22N2S — CID 166283674
(3aR,6aS)-N-[2-(4-methyl-3-pyridinyl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophen-5-amine (PubChem CID 166283674) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is (3aR,6aS)-N-[2-(4-methyl-3-pyridinyl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophen-5-amine.
| Compound Name | (3aR,6aS)-N-[2-(4-methyl-3-pyridinyl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophen-5-amine |
|---|---|
| PubChem CID | 166283674 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (3aR,6aS)-N-[2-(4-methyl-3-pyridinyl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophen-5-amine |
| SMILES | Cc1ccncc1CCNC1C[C@H]2CSC[C@H]2C1 |
| InChI | InChI=1S/C15H22N2S/c1-11-2-4-16-8-12(11)3-5-17-15-6-13-9-18-10-14(13)7-15/h2,4,8,13-15,17H,3,5-7,9-10H2,1H3/t13-,14+,15? |
| InChIKey | HPPQOXCAJWCHBV-YIONKMFJSA-N |
| XLogP | 2.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |