About 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide
3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide (PubChem CID 166283766) has the molecular formula C12H13F2N3O3S
and a molecular weight of 317.32 g/mol. Its IUPAC name is 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide |
| PubChem CID | 166283766 |
| Molecular Formula | C12H13F2N3O3S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide |
| SMILES | N#CC1CN(S(=O)(=O)NCC(O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C12H13F2N3O3S/c13-10-2-1-9(3-11(10)14)12(18)5-16-21(19,20)17-6-8(4-15)7-17/h1-3,8,12,16,18H,5-7H2 |
| InChIKey | PWTACCMPEDVYFN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide?
The IUPAC name of 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide (CID 166283766) is 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide.
What is the SMILES notation for 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide?
The canonical SMILES for 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide is N#CC1CN(S(=O)(=O)NCC(O)c2ccc(F)c(F)c2)C1.
What is the InChIKey of 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide?
The InChIKey is PWTACCMPEDVYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N3O3S/c13-10-2-1-9(3-11(10)14)12(18)5-16-21(19,20)17-6-8(4-15)7-17/h1-3,8,12,16,18H,5-7H2.
What are the key properties of 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide?
3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide has a molecular weight of 317.32 g/mol, XLogP of 0.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]azetidine-1-sulfonamide is sourced from PubChem (CID 166283766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).