C20H26N4O3 — CID 166284546
(1R,3R,4S)-3-[(5-tert-butyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl)amino]bicyclo[2.1.0]pentane-1-carboxylic acid (PubChem CID 166284546) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1R,3R,4S)-3-[(5-tert-butyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl)amino]bicyclo[2.1.0]pentane-1-carboxylic acid.
| Compound Name | (1R,3R,4S)-3-[(5-tert-butyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl)amino]bicyclo[2.1.0]pentane-1-carboxylic acid |
|---|---|
| PubChem CID | 166284546 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (1R,3R,4S)-3-[(5-tert-butyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl)amino]bicyclo[2.1.0]pentane-1-carboxylic acid |
| SMILES | CC(C)(C)c1ncc2c(n1)CC1CCC2N1C(=O)N[C@@H]1C[C@]2(C(=O)O)C[C@H]12 |
| InChI | InChI=1S/C20H26N4O3/c1-19(2,3)16-21-9-11-13(22-16)6-10-4-5-15(11)24(10)18(27)23-14-8-20(17(25)26)7-12(14)20/h9-10,12,14-15H,4-8H2,1-3H3,(H,23,27)(H,25,26)/t10?,12-,14-,15?,20-/m1/s1 |
| InChIKey | JNCDKTBUWCWPHM-WEJQDHTPSA-N |
| XLogP | 2.41 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |