C18H22FNO3 — CID 166284702
2-fluoro-4-[2-oxo-2-[(1,3,4-trimethylcyclohex-3-en-1-yl)amino]ethyl]benzoic acid (PubChem CID 166284702) has the molecular formula C18H22FNO3 and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-fluoro-4-[2-oxo-2-[(1,3,4-trimethylcyclohex-3-en-1-yl)amino]ethyl]benzoic acid.
| Compound Name | 2-fluoro-4-[2-oxo-2-[(1,3,4-trimethylcyclohex-3-en-1-yl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 166284702 |
| Molecular Formula | C18H22FNO3 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-fluoro-4-[2-oxo-2-[(1,3,4-trimethylcyclohex-3-en-1-yl)amino]ethyl]benzoic acid |
| SMILES | CC1=C(C)CC(C)(NC(=O)Cc2ccc(C(=O)O)c(F)c2)CC1 |
| InChI | InChI=1S/C18H22FNO3/c1-11-6-7-18(3,10-12(11)2)20-16(21)9-13-4-5-14(17(22)23)15(19)8-13/h4-5,8H,6-7,9-10H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | XQAIRMOYRMQPST-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|