About 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide
3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide (PubChem CID 166285299) has the molecular formula C19H19FN2O2
and a molecular weight of 326.37 g/mol. Its IUPAC name is 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide |
| PubChem CID | 166285299 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1ccc(F)c(C(=O)NCCC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C19H19FN2O2/c20-17-6-5-15(18(21)23)11-16(17)19(24)22-8-7-12-9-13-3-1-2-4-14(13)10-12/h1-6,11-12H,7-10H2,(H2,21,23)(H,22,24) |
| InChIKey | WHDYKFTVGZNPKN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide?
The IUPAC name of 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide (CID 166285299) is 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide.
What is the SMILES notation for 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide?
The canonical SMILES for 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide is NC(=O)c1ccc(F)c(C(=O)NCCC2Cc3ccccc3C2)c1.
What is the InChIKey of 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide?
The InChIKey is WHDYKFTVGZNPKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O2/c20-17-6-5-15(18(21)23)11-16(17)19(24)22-8-7-12-9-13-3-1-2-4-14(13)10-12/h1-6,11-12H,7-10H2,(H2,21,23)(H,22,24).
What are the key properties of 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide?
3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide has a molecular weight of 326.37 g/mol, XLogP of 2.46, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-4-fluorobenzene-1,3-dicarboxamide is sourced from PubChem (CID 166285299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).