About N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide
N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide (PubChem CID 166286144) has the molecular formula C20H24N4O2
and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide |
| PubChem CID | 166286144 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)N[C@@H]1CC(Cn2cccn2)C[C@H]1O |
| InChI | InChI=1S/C20H24N4O2/c1-14-9-16-5-2-3-6-18(16)24(14)13-20(26)22-17-10-15(11-19(17)25)12-23-8-4-7-21-23/h2-9,15,17,19,25H,10-13H2,1H3,(H,22,26)/t15?,17-,19-/m1/s1 |
| InChIKey | PEYZZXPQVORQME-GERZZCHPSA-N |
| XLogP | 2.10 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide?
The IUPAC name of N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide (CID 166286144) is N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide.
What is the SMILES notation for N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide?
The canonical SMILES for N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide is Cc1cc2ccccc2n1CC(=O)N[C@@H]1CC(Cn2cccn2)C[C@H]1O.
What is the InChIKey of N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide?
The InChIKey is PEYZZXPQVORQME-GERZZCHPSA-N. The full InChI is InChI=1S/C20H24N4O2/c1-14-9-16-5-2-3-6-18(16)24(14)13-20(26)22-17-10-15(11-19(17)25)12-23-8-4-7-21-23/h2-9,15,17,19,25H,10-13H2,1H3,(H,22,26)/t15?,17-,19-/m1/s1.
What are the key properties of N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide?
N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide has a molecular weight of 352.44 g/mol, XLogP of 2.10, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-hydroxy-4-(pyrazol-1-ylmethyl)cyclopentyl]-2-(2-methylindol-1-yl)acetamide is sourced from PubChem (CID 166286144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).