About N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide
N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide (PubChem CID 166286555) has the molecular formula C17H19F3N4O
and a molecular weight of 352.36 g/mol. Its IUPAC name is N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide |
| PubChem CID | 166286555 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide |
| SMILES | CC1(CNC(=O)Cc2ccn(-c3ccc(F)cc3)n2)CC(F)(F)CN1 |
| InChI | InChI=1S/C17H19F3N4O/c1-16(9-17(19,20)11-22-16)10-21-15(25)8-13-6-7-24(23-13)14-4-2-12(18)3-5-14/h2-7,22H,8-11H2,1H3,(H,21,25) |
| InChIKey | GUOZHEIZSXIAQS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide?
The IUPAC name of N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide (CID 166286555) is N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide.
What is the SMILES notation for N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide?
The canonical SMILES for N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide is CC1(CNC(=O)Cc2ccn(-c3ccc(F)cc3)n2)CC(F)(F)CN1.
What is the InChIKey of N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide?
The InChIKey is GUOZHEIZSXIAQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3N4O/c1-16(9-17(19,20)11-22-16)10-21-15(25)8-13-6-7-24(23-13)14-4-2-12(18)3-5-14/h2-7,22H,8-11H2,1H3,(H,21,25).
What are the key properties of N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide?
N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide has a molecular weight of 352.36 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,4-difluoro-2-methylpyrrolidin-2-yl)methyl]-2-[1-(4-fluorophenyl)pyrazol-3-yl]acetamide is sourced from PubChem (CID 166286555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).